| Name | Manganese oxalate |
| Synonyms | Manganousoxalate MANGANESE OXALATE Manganese oxalate MANGANESE (II) OXALATE manganese(2+) ethanedioate MANGANESE(II) OXALATE 2 H2O Manganese(II)oxalate2-hydrate Manganese, (ethanedioato(2-)-kappaO1,kappaO2)- Manganese, ethanedioato(2-)-.kappa.O1,.kappa.O2- |
| CAS | 640-67-5 110580-21-7 |
| EINECS | 211-367-3 |
| InChI | InChI=1/C2H2O4.Mn/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);/q;+2/p-2 |
| Molecular Formula | C2MnO4 |
| Molar Mass | 142.96 |
| Density | 0.82[at 20℃] |
| Boling Point | 375℃[at 101 325 Pa] |
| Flash Point | 188.8°C |
| Water Solubility | 300mg/L at 20℃ |
| Vapor Presure | 2.51E-06mmHg at 25°C |
| pKa | 3.81[at 20 ℃] |
| Storage Condition | RT, dry |
| Use | Used as a drying agent for paints and varnishes |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| solubility in water (g/100ml) | grams dissolved per 100ml of water at different temperatures (℃): 2 × 10-2/30 ℃;2.4 × 10-2/10 ℃;2.8 × 10-2/20 ℃;3.3 × 10-2/30 ℃ |
| Use | desiccant for paints and varnishes |